17β-Estradiol 3-O-Sulfate (sodium salt)

β-Estradiol 3-sulfate sodium salt functions as a steroid hormone and exhibits estrogenic activity. It acts by binding to estrogen receptors, estrogen receptor alpha and beta, within the cell nucleus. This binding initiates a cascade of molecular events, leading to the regulation of gene expression and the modulation of various cellular processes. β-Estradiol 3-sulfate sodium salt′s mechanism of action involves influencing the transcription of target genes, thereby impacting the physiological responses of the cells. By interacting with estrogen receptors, β-Estradiol 3-sulfate sodium salt plays a role in the regulation of cell proliferation, differentiation, and apoptosis. Its activity at the molecular level contributes to the modulation of various signaling pathways and cellular functions, making it a relevant component in studies exploring hormone signaling and related biological processes.

Specifictaions: ≥98%

MDL Number: C18H23O5S • Na

Molecular Formula: 374.43

PubChem CID: 23691039

Isomeric SMILES: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)OS(=O)(=O)[O-].[Na+]