Fmoc-3-methoxy-L-tyrosine (C007B-167563)

Fmoc-3-methoxy-L-tyrosine is an Fmoc protected tyrosine derivative that is potentially useful for proteomics studies and solid phase peptide synthesis techniques. Tyrosine is a very important amino acid - one of the few amino acids which is phosphorylated to vary the physical properties of the peptides, and is a precursor for the formation of iodinated thyroid hormones. The Fmoc group is typically removed with a base such as pyridine - an orthogonal de-protection strategy to the acid labilie Boc group.

Specifications and Purity: ≥98%

Molecular Formula: C25H23NO6

Molecular Weight: 433.47

PubChem CID: 11690590

Isomeric SMILES: COC1=C(C=CC(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O

Related Documents: https://aladdin-for-icloud-store.oss-cn-hangzhou.aliyuncs.com/aladdinsci/pdp/sds/1/F350820-SCI_176d00c15e157cdade0e2d21eb70e322.pdf