Erythromycin B (C007B-153099)

Erythromycin B (12-deoxyerythromycin A) is a minor co-metabolite of erythromycin produced by fermentation of Saccharopolyspora erythreae. Erythromycin B exhibits broad spectrum antibiotic activity,albeit less potent than erythromycin A. Erythromycin B played an integral part of the structure activityrelationship studies of semi-synthetic erythromycins, however none reached clinical development.

Specifications and Purity: ≥90%

Molecular Formula: C37H67NO12

Molecular Weight: 717.93

PubChem CID: 9918244

Isomeric SMILES: CC[C@@H]1[C@@H]([C@@H]([C@H](C(=O)[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)C)C)O)C

Beilstein Registry Number: 5206722

Related Documents: https://aladdin-for-icloud-store.oss-cn-hangzhou.aliyuncs.com/aladdinsci/pdp/sds/1/E329425-SCI_3195156aa3b520b3237313d4b07c76ba.pdf