Enniatin B (C007B-185630)

Enniatin B is an ionophore antibiotic and fungal metabolite generated by multiple|Fusarium|strains. Studies indicate that Enniatin B has cytotoxic activity|in vitro|, but no genotoxic activity. Enniatin B has been shown to inhibit the Pdr5p ABC transporter in|Saccharomyces cerevisiae|, as well as acyl-CoA-cholesterol acyltransferase (ACAT). Additionally, joint studies of valinomycin and enniatin B have demonstrated that they can bind to calmodulin (CaM) and inhibit the activity of 3',5'-cyclic nucleotide phosphodiesterase (PDE). It is believed that enniatin B possess anticancer properties.

Specifications and Purity: ≥90%(HPLC)

Molecular Formula: C33H57N3O9

Molecular Weight: 639.82

PubChem CID: 164754

Isomeric SMILES: CC(C)[C@H]1C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N1C)C(C)C)C(C)C)C)C(C)C)C(C)C)C)C(C)C

Related Documents: https://aladdin-for-icloud-store.oss-cn-hangzhou.aliyuncs.com/aladdinsci/pdp/sds/1/E329483-SCI_0b58ea56e28df8c565cba336edadaa5a.pdf