D-Maltotriose Peracetate, a derivative of maltotriose, has garnered attention in scientific research for its utility in various applications, particularly in carbohydrate chemistry and enzymology. As a peracetate derivative, it serves as a versatile substrate for enzymatic studies and kinetic analyses of enzymes involved in carbohydrate metabolism. One notable research application involves its use as a substrate for glycoside hydrolases, glycosyltransferases, and other carbohydrate-active enzymes. By enzymatically hydrolyzing D-Maltotriose Peracetate, researchers can explain the catalytic mechanisms, substrate specificity, and kinetics of these enzymes, contributing to a deeper understanding of carbohydrate processing pathways in biological systems. Furthermore, D-Maltotriose Peracetate and its derivatives have been employed in the synthesis of complex carbohydrate structures and glycotechnology research. These compounds serve as valuable tools for the preparation of glycoconjugates, glycomimetics, and carbohydrate-based materials, facilitating investigations into carbohydrate-protein interactions, cell surface recognition, and carbohydrate-mediated biological processes. Overall, D-Maltotriose Peracetate plays a crucial role in advancing research endeavors aimed at unraveling the intricacies of carbohydrate biochemistry and exploring their diverse applications in various scientific fields.
Specifictaions: ≥95%
MDL Number: C40H54O27
Molecular Formula: 966.84
PubChem CID: 11480116
Isomeric SMILES: CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](OC([C@@H]([C@H]2OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C
Related Documents: https://ald-pub-files.oss-cn-shanghai.aliyuncs.com/aladdinsci/pdp/sds/1/D350756-SCI_656fcdd9ee888f400e74637ffcf0ac28.pdf
- UPC:
- 12352312
- Condition:
- New
- HazmatClass:
- No
- WeightUOM:
- LB
- MPN:
- D350756-50mg
- CAS:
- 93911-20-7
- Product Size:
- 50mg
akash.verma@cenmed.com
(732) 447-1115





