Chymostatin (C007B-078209)

Chymostatin is a bioactive peptide protease inhibitor that contains chymostatin A as a major form. The compound specifically inhibits chymotrypsin (CTR) (ID50 = 150 ηg/ml), papain (ID50 = 7.5 μg/ml), and cathepsin G along with most cysteine proteases such as cathepsin A, B, H, and L. The compound has been noted as a strong inhibitor of cathepsins A, B, and C. Chymostatin at an effective concentration of 10 to 100 μM weakly inhibits human leukocyte Elastase-1. In rat muscle homogenates chymostatin inhibited the protease cathepsin B and other soluble Ca2+ activated proteases. In the same study, chymostatin decreased protein break down by 20-40% without inhibiting protein production.

Specifications and Purity: ≥95%

MDL Number: MFCD00071059

Molecular Formula: C31H41N7O6

Molecular Weight: 607.7

PubChem CID: 103535

Isomeric SMILES: CC(C)CC(C(=O)NC(CC1=CC=CC=C1)C=O)NC(=O)C(C2CCN=C(N2)N)NC(=O)NC(CC3=CC=CC=C3)C(=O)O

Related Documents: https://aladdin-for-icloud-store.oss-cn-hangzhou.aliyuncs.com/aladdinsci/pdp/sds/1/C113165-SCI_b884d29c313dca5578058b765b6497ec.pdf